C11H20O9S2 — CID 58747759
(2R,3R,4S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4-hydroxy-5-methyloxolane-3-sulfonoperoxoate (PubChem CID 58747759) has the molecular formula C11H20O9S2 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R,3R,4S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4-hydroxy-5-methyloxolane-3-sulfonoperoxoate.
| Compound Name | (2R,3R,4S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4-hydroxy-5-methyloxolane-3-sulfonoperoxoate |
|---|---|
| PubChem CID | 58747759 |
| Molecular Formula | C11H20O9S2 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (2R,3R,4S)-2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-4-hydroxy-5-methyloxolane-3-sulfonoperoxoate |
| SMILES | CC1O[C@H](C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)[C@H](S(=O)(=O)O[O-])[C@H]1O |
| InChI | InChI=1S/C11H20O9S2/c1-5-9(14)11(22(17,18)20-16)7(19-5)4-21-3-6(13)10(15)8(21)2-12/h5-15H,2-4H2,1H3/t5?,6-,7-,8-,9+,10+,11+,21?/m1/s1 |
| InChIKey | SSGBYYLKEIUCQV-VSEILJTMSA-N |
| XLogP | -4.16 |
| TPSA | 156.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|