C11H18O6S — CID 117168508
3-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]propanoic acid (PubChem CID 117168508) has the molecular formula C11H18O6S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]propanoic acid.
| Compound Name | 3-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 117168508 |
| Molecular Formula | C11H18O6S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-[2-(1,1-dioxothian-4-yl)-1,3-dioxolan-4-yl]propanoic acid |
| SMILES | O=C(O)CCC1COC(C2CCS(=O)(=O)CC2)O1 |
| InChI | InChI=1S/C11H18O6S/c12-10(13)2-1-9-7-16-11(17-9)8-3-5-18(14,15)6-4-8/h8-9,11H,1-7H2,(H,12,13) |
| InChIKey | QUOHFOPODFKSPD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |