C10H18O3S — CID 117168739
2-[2-(thian-3-yl)-1,3-dioxolan-4-yl]ethanol (PubChem CID 117168739) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[2-(thian-3-yl)-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[2-(thian-3-yl)-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 117168739 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 2-[2-(thian-3-yl)-1,3-dioxolan-4-yl]ethanol |
| SMILES | OCCC1COC(C2CCCSC2)O1 |
| InChI | InChI=1S/C10H18O3S/c11-4-3-9-6-12-10(13-9)8-2-1-5-14-7-8/h8-11H,1-7H2 |
| InChIKey | FGQAYNGYIMQGOW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |