2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid

C11H18O6S — CID 117169154

IUPAC2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid
SMILESO=C(O)CC1COC(CC2CCCCS2(=O)=O)O1
InChIInChI=1S/C11H18O6S/c12-10(13)5-8-7-16-11(17-8)6-9-3-1-2-4-18(9,14)15/h8-9,11H,1-7H2,(H,12,13)
InChIKeyCVNJWNYXJZVYIB-UHFFFAOYSA-N
MW278.33 g/mol
LogP0.56
Rot. Bonds4

About 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid

2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid (PubChem CID 117169154) has the molecular formula C11H18O6S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid
PubChem CID117169154
Molecular FormulaC11H18O6S
Molecular Weight278.33 g/mol
Exact Mass278.08
IUPAC Name2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid
SMILESO=C(O)CC1COC(CC2CCCCS2(=O)=O)O1
InChIInChI=1S/C11H18O6S/c12-10(13)5-8-7-16-11(17-8)6-9-3-1-2-4-18(9,14)15/h8-9,11H,1-7H2,(H,12,13)
InChIKeyCVNJWNYXJZVYIB-UHFFFAOYSA-N
XLogP0.56
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.33
LogP ≤ 50.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid?
The IUPAC name of 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid (CID 117169154) is 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid?
The canonical SMILES for 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid is O=C(O)CC1COC(CC2CCCCS2(=O)=O)O1.
What is the InChIKey of 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid?
The InChIKey is CVNJWNYXJZVYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6S/c12-10(13)5-8-7-16-11(17-8)6-9-3-1-2-4-18(9,14)15/h8-9,11H,1-7H2,(H,12,13).
What are the key properties of 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid?
2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid has a molecular weight of 278.33 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(1,1-dioxothian-2-yl)methyl]-1,3-dioxolan-4-yl]acetic acid is sourced from PubChem (CID 117169154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).