C19H32O3Si — CID 11717029
ethyl 5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylnona-7,8-dien-2-ynoate (PubChem CID 11717029) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is ethyl 5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylnona-7,8-dien-2-ynoate.
| Compound Name | ethyl 5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylnona-7,8-dien-2-ynoate |
|---|---|
| PubChem CID | 11717029 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | ethyl 5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylnona-7,8-dien-2-ynoate |
| SMILES | C=C=CC(C)(C)C(CC#CC(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O3Si/c1-10-15-19(6,7)16(13-12-14-17(20)21-11-2)22-23(8,9)18(3,4)5/h15-16H,1,11,13H2,2-9H3 |
| InChIKey | MJTSXIDBCTVEIL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|