C15H11FO4S — CID 117170658
3-[(3-fluorophenoxy)methyl]-1,1-dioxo-1-benzothiophen-4-ol (PubChem CID 117170658) has the molecular formula C15H11FO4S and a molecular weight of 306.31 g/mol. Its IUPAC name is 3-[(3-fluorophenoxy)methyl]-1,1-dioxo-1-benzothiophen-4-ol.
| Compound Name | 3-[(3-fluorophenoxy)methyl]-1,1-dioxo-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 117170658 |
| Molecular Formula | C15H11FO4S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-[(3-fluorophenoxy)methyl]-1,1-dioxo-1-benzothiophen-4-ol |
| SMILES | O=S1(=O)C=C(COc2cccc(F)c2)c2c(O)cccc21 |
| InChI | InChI=1S/C15H11FO4S/c16-11-3-1-4-12(7-11)20-8-10-9-21(18,19)14-6-2-5-13(17)15(10)14/h1-7,9,17H,8H2 |
| InChIKey | XIISVIHOLQVEDE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |