C9H7FN2OS — CID 130899394
3-[(3-fluorophenoxy)methyl]-1,2,5-thiadiazole (PubChem CID 130899394) has the molecular formula C9H7FN2OS and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-[(3-fluorophenoxy)methyl]-1,2,5-thiadiazole.
| Compound Name | 3-[(3-fluorophenoxy)methyl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 130899394 |
| Molecular Formula | C9H7FN2OS |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 3-[(3-fluorophenoxy)methyl]-1,2,5-thiadiazole |
| SMILES | Fc1cccc(OCc2cnsn2)c1 |
| InChI | InChI=1S/C9H7FN2OS/c10-7-2-1-3-9(4-7)13-6-8-5-11-14-12-8/h1-5H,6H2 |
| InChIKey | APLWYTVVWUHJNA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |