C9H7FN2OS2 — CID 130927637
3-[(3-fluorophenyl)sulfinylmethyl]-1,2,5-thiadiazole (PubChem CID 130927637) has the molecular formula C9H7FN2OS2 and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)sulfinylmethyl]-1,2,5-thiadiazole.
| Compound Name | 3-[(3-fluorophenyl)sulfinylmethyl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 130927637 |
| Molecular Formula | C9H7FN2OS2 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 3-[(3-fluorophenyl)sulfinylmethyl]-1,2,5-thiadiazole |
| SMILES | O=S(Cc1cnsn1)c1cccc(F)c1 |
| InChI | InChI=1S/C9H7FN2OS2/c10-7-2-1-3-9(4-7)15(13)6-8-5-11-14-12-8/h1-5H,6H2 |
| InChIKey | VBOURUQOWDPELM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |