C19H20N2O2S — CID 11717092
(3S,7aR)-6-benzyl-7-methoxy-3-phenyl-1,3,7,7a-tetrahydroimidazo[1,5-c][1,3]thiazol-5-one (PubChem CID 11717092) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (3S,7aR)-6-benzyl-7-methoxy-3-phenyl-1,3,7,7a-tetrahydroimidazo[1,5-c][1,3]thiazol-5-one.
| Compound Name | (3S,7aR)-6-benzyl-7-methoxy-3-phenyl-1,3,7,7a-tetrahydroimidazo[1,5-c][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 11717092 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3S,7aR)-6-benzyl-7-methoxy-3-phenyl-1,3,7,7a-tetrahydroimidazo[1,5-c][1,3]thiazol-5-one |
| SMILES | COC1[C@@H]2CS[C@@H](c3ccccc3)N2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-23-17-16-13-24-18(15-10-6-3-7-11-15)21(16)19(22)20(17)12-14-8-4-2-5-9-14/h2-11,16-18H,12-13H2,1H3/t16-,17?,18-/m0/s1 |
| InChIKey | ZOWJTCLBLCUHCR-RGBJRUIASA-N |
| XLogP | 3.71 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |