C24H30N2O2S — CID 67753595
(7aR)-6-benzyl-7-hexoxy-3-phenyl-1,3,7,7a-tetrahydroimidazo[1,5-c][1,3]thiazol-5-one (PubChem CID 67753595) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is (7aR)-6-benzyl-7-hexoxy-3-phenyl-1,3,7,7a-tetrahydroimidazo[1,5-c][1,3]thiazol-5-one.
| Compound Name | (7aR)-6-benzyl-7-hexoxy-3-phenyl-1,3,7,7a-tetrahydroimidazo[1,5-c][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 67753595 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (7aR)-6-benzyl-7-hexoxy-3-phenyl-1,3,7,7a-tetrahydroimidazo[1,5-c][1,3]thiazol-5-one |
| SMILES | CCCCCCOC1[C@@H]2CSC(c3ccccc3)N2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H30N2O2S/c1-2-3-4-11-16-28-22-21-18-29-23(20-14-9-6-10-15-20)26(21)24(27)25(22)17-19-12-7-5-8-13-19/h5-10,12-15,21-23H,2-4,11,16-18H2,1H3/t21-,22?,23?/m0/s1 |
| InChIKey | HVGOXKCZDDRCPF-UVKLAMSESA-N |
| XLogP | 5.66 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|