C14H18N2 — CID 117173088
N-[(1-methylindol-2-yl)methyl]cyclobutanamine (PubChem CID 117173088) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-[(1-methylindol-2-yl)methyl]cyclobutanamine.
| Compound Name | N-[(1-methylindol-2-yl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 117173088 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-[(1-methylindol-2-yl)methyl]cyclobutanamine |
| SMILES | Cn1c(CNC2CCC2)cc2ccccc21 |
| InChI | InChI=1S/C14H18N2/c1-16-13(10-15-12-6-4-7-12)9-11-5-2-3-8-14(11)16/h2-3,5,8-9,12,15H,4,6-7,10H2,1H3 |
| InChIKey | LORLNIDNCWATJX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |