C15H19ClN2 — CID 117173103
N-[(4-chloro-1-methylindol-2-yl)methyl]cyclopentanamine (PubChem CID 117173103) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is N-[(4-chloro-1-methylindol-2-yl)methyl]cyclopentanamine.
| Compound Name | N-[(4-chloro-1-methylindol-2-yl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 117173103 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-[(4-chloro-1-methylindol-2-yl)methyl]cyclopentanamine |
| SMILES | Cn1c(CNC2CCCC2)cc2c(Cl)cccc21 |
| InChI | InChI=1S/C15H19ClN2/c1-18-12(10-17-11-5-2-3-6-11)9-13-14(16)7-4-8-15(13)18/h4,7-9,11,17H,2-3,5-6,10H2,1H3 |
| InChIKey | LPILYJMAJGOUPY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |