C12H20N2 — CID 100792166
N-[(1,5-dimethylpyrrol-2-yl)methyl]cyclopentanamine (PubChem CID 100792166) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrrol-2-yl)methyl]cyclopentanamine.
| Compound Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 100792166 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]cyclopentanamine |
| SMILES | Cc1ccc(CNC2CCCC2)n1C |
| InChI | InChI=1S/C12H20N2/c1-10-7-8-12(14(10)2)9-13-11-5-3-4-6-11/h7-8,11,13H,3-6,9H2,1-2H3 |
| InChIKey | ZHHVSNJTLPBJLS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |