C15H26N2 — CID 66410893
N-[(1-ethylpyrrol-2-yl)methyl]cyclooctanamine (PubChem CID 66410893) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-[(1-ethylpyrrol-2-yl)methyl]cyclooctanamine.
| Compound Name | N-[(1-ethylpyrrol-2-yl)methyl]cyclooctanamine |
|---|---|
| PubChem CID | 66410893 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-[(1-ethylpyrrol-2-yl)methyl]cyclooctanamine |
| SMILES | CCn1cccc1CNC1CCCCCCC1 |
| InChI | InChI=1S/C15H26N2/c1-2-17-12-8-11-15(17)13-16-14-9-6-4-3-5-7-10-14/h8,11-12,14,16H,2-7,9-10,13H2,1H3 |
| InChIKey | HAVAWNQNGXHGLW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |