C18H23ClN2 — CID 42761712
N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]cyclohexanamine (PubChem CID 42761712) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]cyclohexanamine.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 42761712 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]cyclohexanamine |
| SMILES | Clc1ccccc1Cn1cccc1CNC1CCCCC1 |
| InChI | InChI=1S/C18H23ClN2/c19-18-11-5-4-7-15(18)14-21-12-6-10-17(21)13-20-16-8-2-1-3-9-16/h4-7,10-12,16,20H,1-3,8-9,13-14H2 |
| InChIKey | CGYMTXZZYNSTPU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |