C10H8O4S2 — CID 117174603
1,1-dioxo-3-(sulfanylmethyl)-1-benzothiophene-5-carboxylic acid (PubChem CID 117174603) has the molecular formula C10H8O4S2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1,1-dioxo-3-(sulfanylmethyl)-1-benzothiophene-5-carboxylic acid.
| Compound Name | 1,1-dioxo-3-(sulfanylmethyl)-1-benzothiophene-5-carboxylic acid |
|---|---|
| PubChem CID | 117174603 |
| Molecular Formula | C10H8O4S2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 1,1-dioxo-3-(sulfanylmethyl)-1-benzothiophene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(CS)=CS2(=O)=O |
| InChI | InChI=1S/C10H8O4S2/c11-10(12)6-1-2-9-8(3-6)7(4-15)5-16(9,13)14/h1-3,5,15H,4H2,(H,11,12) |
| InChIKey | YLYMXRVEDVFFIS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|