C17H23ClN2 — CID 117175445
N-[(5-chloro-1-propan-2-ylindol-3-yl)methyl]cyclopentanamine (PubChem CID 117175445) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is N-[(5-chloro-1-propan-2-ylindol-3-yl)methyl]cyclopentanamine.
| Compound Name | N-[(5-chloro-1-propan-2-ylindol-3-yl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 117175445 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-[(5-chloro-1-propan-2-ylindol-3-yl)methyl]cyclopentanamine |
| SMILES | CC(C)n1cc(CNC2CCCC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H23ClN2/c1-12(2)20-11-13(10-19-15-5-3-4-6-15)16-9-14(18)7-8-17(16)20/h7-9,11-12,15,19H,3-6,10H2,1-2H3 |
| InChIKey | TXWAOCWBWQKREE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |