C16H22N2 — CID 117185629
N-[(1,6-dimethylindol-3-yl)methyl]cyclopentanamine (PubChem CID 117185629) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-[(1,6-dimethylindol-3-yl)methyl]cyclopentanamine.
| Compound Name | N-[(1,6-dimethylindol-3-yl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 117185629 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-[(1,6-dimethylindol-3-yl)methyl]cyclopentanamine |
| SMILES | Cc1ccc2c(CNC3CCCC3)cn(C)c2c1 |
| InChI | InChI=1S/C16H22N2/c1-12-7-8-15-13(11-18(2)16(15)9-12)10-17-14-5-3-4-6-14/h7-9,11,14,17H,3-6,10H2,1-2H3 |
| InChIKey | NJGIOCUHOZEHJC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |