C17H13ClF3NOS — CID 11717683
5-chloro-4,4-dimethyl-6-[3-(trifluoromethyl)phenyl]-1H-3,1-benzoxazine-2-thione (PubChem CID 11717683) has the molecular formula C17H13ClF3NOS and a molecular weight of 371.81 g/mol. Its IUPAC name is 5-chloro-4,4-dimethyl-6-[3-(trifluoromethyl)phenyl]-1H-3,1-benzoxazine-2-thione.
| Compound Name | 5-chloro-4,4-dimethyl-6-[3-(trifluoromethyl)phenyl]-1H-3,1-benzoxazine-2-thione |
|---|---|
| PubChem CID | 11717683 |
| Molecular Formula | C17H13ClF3NOS |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 5-chloro-4,4-dimethyl-6-[3-(trifluoromethyl)phenyl]-1H-3,1-benzoxazine-2-thione |
| SMILES | CC1(C)OC(=S)Nc2ccc(-c3cccc(C(F)(F)F)c3)c(Cl)c21 |
| InChI | InChI=1S/C17H13ClF3NOS/c1-16(2)13-12(22-15(24)23-16)7-6-11(14(13)18)9-4-3-5-10(8-9)17(19,20)21/h3-8H,1-2H3,(H,22,24) |
| InChIKey | YBNSGFFPVFYTHW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|