C11H12FNO — CID 117176892
5-fluoro-2-(methoxymethyl)-1-methylindole (PubChem CID 117176892) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 5-fluoro-2-(methoxymethyl)-1-methylindole.
| Compound Name | 5-fluoro-2-(methoxymethyl)-1-methylindole |
|---|---|
| PubChem CID | 117176892 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-fluoro-2-(methoxymethyl)-1-methylindole |
| SMILES | COCc1cc2cc(F)ccc2n1C |
| InChI | InChI=1S/C11H12FNO/c1-13-10(7-14-2)6-8-5-9(12)3-4-11(8)13/h3-6H,7H2,1-2H3 |
| InChIKey | FXBDCOBBSDCUTA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |