C17H25ClN2O — CID 3043818
3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-methylpropan-1-amine;hydrochloride (PubChem CID 3043818) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-methylpropan-1-amine;hydrochloride.
| Compound Name | 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3043818 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-methylpropan-1-amine;hydrochloride |
| SMILES | CNCCCC1(C)OCCn2c1c(C)c1ccccc12.Cl |
| InChI | InChI=1S/C17H24N2O.ClH/c1-13-14-7-4-5-8-15(14)19-11-12-20-17(2,16(13)19)9-6-10-18-3;/h4-5,7-8,18H,6,9-12H2,1-3H3;1H |
| InChIKey | GHDNJUIPYGURPZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|