C21H26N2O2 — CID 25227568
(12R)-12-ethyl-17-(methoxymethyl)-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaen-9-one (PubChem CID 25227568) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (12R)-12-ethyl-17-(methoxymethyl)-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaen-9-one.
| Compound Name | (12R)-12-ethyl-17-(methoxymethyl)-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaen-9-one |
|---|---|
| PubChem CID | 25227568 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (12R)-12-ethyl-17-(methoxymethyl)-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaen-9-one |
| SMILES | CC[C@]12CCCn3c(COC)cc(c31)-c1ccccc1NC(=O)CC2 |
| InChI | InChI=1S/C21H26N2O2/c1-3-21-10-6-12-23-15(14-25-2)13-17(20(21)23)16-7-4-5-8-18(16)22-19(24)9-11-21/h4-5,7-8,13H,3,6,9-12,14H2,1-2H3,(H,22,24)/t21-/m1/s1 |
| InChIKey | FGHROJSHRIKSBW-OAQYLSRUSA-N |
| XLogP | 4.48 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |