C20H25N3O3 — CID 118734978
(3S,6S)-3-[methoxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione (PubChem CID 118734978) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (3S,6S)-3-[methoxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3-[methoxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 118734978 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (3S,6S)-3-[methoxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione |
| SMILES | C=CC(C)(C)c1[nH]c2ccccc2c1C(OC)[C@@H]1NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C20H25N3O3/c1-6-20(3,4)17-14(12-9-7-8-10-13(12)22-17)16(26-5)15-19(25)21-11(2)18(24)23-15/h6-11,15-16,22H,1H2,2-5H3,(H,21,25)(H,23,24)/t11-,15-,16?/m0/s1 |
| InChIKey | IYOQFKGLWNJULG-QUJPKXGGSA-N |
| XLogP | 2.32 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|