C19H29ClN2O — CID 3043838
4-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylbutan-1-amine;hydrochloride (PubChem CID 3043838) has the molecular formula C19H29ClN2O and a molecular weight of 336.91 g/mol. Its IUPAC name is 4-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylbutan-1-amine;hydrochloride.
| Compound Name | 4-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3043838 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylbutan-1-amine;hydrochloride |
| SMILES | CCNCCCCC1(C)OCCn2c1c(C)c1ccccc12.Cl |
| InChI | InChI=1S/C19H28N2O.ClH/c1-4-20-12-8-7-11-19(3)18-15(2)16-9-5-6-10-17(16)21(18)13-14-22-19;/h5-6,9-10,20H,4,7-8,11-14H2,1-3H3;1H |
| InChIKey | OHVVYNNQGRLSAJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|