C22H28N2O2 — CID 25227569
(12R)-17-(ethoxymethyl)-12-ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaen-9-one (PubChem CID 25227569) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (12R)-17-(ethoxymethyl)-12-ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaen-9-one.
| Compound Name | (12R)-17-(ethoxymethyl)-12-ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaen-9-one |
|---|---|
| PubChem CID | 25227569 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (12R)-17-(ethoxymethyl)-12-ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(19),2,4,6,17-pentaen-9-one |
| SMILES | CCOCc1cc2c3n1CCC[C@]3(CC)CCC(=O)Nc1ccccc1-2 |
| InChI | InChI=1S/C22H28N2O2/c1-3-22-11-7-13-24-16(15-26-4-2)14-18(21(22)24)17-8-5-6-9-19(17)23-20(25)10-12-22/h5-6,8-9,14H,3-4,7,10-13,15H2,1-2H3,(H,23,25)/t22-/m1/s1 |
| InChIKey | UNVXNWJNODKIRV-JOCHJYFZSA-N |
| XLogP | 4.87 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |