C18H27ClN2O — CID 3043828
3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylpropan-1-amine;hydrochloride (PubChem CID 3043828) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylpropan-1-amine;hydrochloride.
| Compound Name | 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3043828 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylpropan-1-amine;hydrochloride |
| SMILES | CCNCCCC1(C)OCCn2c1c(C)c1ccccc12.Cl |
| InChI | InChI=1S/C18H26N2O.ClH/c1-4-19-11-7-10-18(3)17-14(2)15-8-5-6-9-16(15)20(17)12-13-21-18;/h5-6,8-9,19H,4,7,10-13H2,1-3H3;1H |
| InChIKey | OJKJCDIACMRSPM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|