C18H27N3 — CID 117177017
[2-(piperidin-1-ylmethyl)-1-propan-2-ylindol-5-yl]methanamine (PubChem CID 117177017) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is [2-(piperidin-1-ylmethyl)-1-propan-2-ylindol-5-yl]methanamine.
| Compound Name | [2-(piperidin-1-ylmethyl)-1-propan-2-ylindol-5-yl]methanamine |
|---|---|
| PubChem CID | 117177017 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | [2-(piperidin-1-ylmethyl)-1-propan-2-ylindol-5-yl]methanamine |
| SMILES | CC(C)n1c(CN2CCCCC2)cc2cc(CN)ccc21 |
| InChI | InChI=1S/C18H27N3/c1-14(2)21-17(13-20-8-4-3-5-9-20)11-16-10-15(12-19)6-7-18(16)21/h6-7,10-11,14H,3-5,8-9,12-13,19H2,1-2H3 |
| InChIKey | LBRZXUUEWVYPTH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |