C18H26N2 — CID 117184903
4-methyl-2-(piperidin-1-ylmethyl)-1-propan-2-ylindole (PubChem CID 117184903) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-methyl-2-(piperidin-1-ylmethyl)-1-propan-2-ylindole.
| Compound Name | 4-methyl-2-(piperidin-1-ylmethyl)-1-propan-2-ylindole |
|---|---|
| PubChem CID | 117184903 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4-methyl-2-(piperidin-1-ylmethyl)-1-propan-2-ylindole |
| SMILES | Cc1cccc2c1cc(CN1CCCCC1)n2C(C)C |
| InChI | InChI=1S/C18H26N2/c1-14(2)20-16(13-19-10-5-4-6-11-19)12-17-15(3)8-7-9-18(17)20/h7-9,12,14H,4-6,10-11,13H2,1-3H3 |
| InChIKey | MXXAIXGWEDFISM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |