C18H27N3 — CID 117186565
7-methyl-2-[(4-methylpiperazin-1-yl)methyl]-1-propan-2-ylindole (PubChem CID 117186565) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 7-methyl-2-[(4-methylpiperazin-1-yl)methyl]-1-propan-2-ylindole.
| Compound Name | 7-methyl-2-[(4-methylpiperazin-1-yl)methyl]-1-propan-2-ylindole |
|---|---|
| PubChem CID | 117186565 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 7-methyl-2-[(4-methylpiperazin-1-yl)methyl]-1-propan-2-ylindole |
| SMILES | Cc1cccc2cc(CN3CCN(C)CC3)n(C(C)C)c12 |
| InChI | InChI=1S/C18H27N3/c1-14(2)21-17(13-20-10-8-19(4)9-11-20)12-16-7-5-6-15(3)18(16)21/h5-7,12,14H,8-11,13H2,1-4H3 |
| InChIKey | HIYLBQUXULTULT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |