C17H26N4 — CID 117173772
2-[(4-methylpiperazin-1-yl)methyl]-1-propan-2-ylindol-4-amine (PubChem CID 117173772) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)methyl]-1-propan-2-ylindol-4-amine.
| Compound Name | 2-[(4-methylpiperazin-1-yl)methyl]-1-propan-2-ylindol-4-amine |
|---|---|
| PubChem CID | 117173772 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)methyl]-1-propan-2-ylindol-4-amine |
| SMILES | CC(C)n1c(CN2CCN(C)CC2)cc2c(N)cccc21 |
| InChI | InChI=1S/C17H26N4/c1-13(2)21-14(12-20-9-7-19(3)8-10-20)11-15-16(18)5-4-6-17(15)21/h4-6,11,13H,7-10,12,18H2,1-3H3 |
| InChIKey | DVTZHHBEEBFRQV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|