C14H17NO3S — CID 117177811
3-[(cyclopentylamino)methyl]-1,1-dioxo-1-benzothiophen-6-ol (PubChem CID 117177811) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-[(cyclopentylamino)methyl]-1,1-dioxo-1-benzothiophen-6-ol.
| Compound Name | 3-[(cyclopentylamino)methyl]-1,1-dioxo-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 117177811 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-[(cyclopentylamino)methyl]-1,1-dioxo-1-benzothiophen-6-ol |
| SMILES | O=S1(=O)C=C(CNC2CCCC2)c2ccc(O)cc21 |
| InChI | InChI=1S/C14H17NO3S/c16-12-5-6-13-10(8-15-11-3-1-2-4-11)9-19(17,18)14(13)7-12/h5-7,9,11,15-16H,1-4,8H2 |
| InChIKey | CHDGAZGNYIKMFF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |