C21H31NO5 — CID 11717794
ethyl 1-(3-ethoxy-3-oxopropyl)-6-(phenylmethoxymethyl)piperidine-3-carboxylate (PubChem CID 11717794) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is ethyl 1-(3-ethoxy-3-oxopropyl)-6-(phenylmethoxymethyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(3-ethoxy-3-oxopropyl)-6-(phenylmethoxymethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 11717794 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | ethyl 1-(3-ethoxy-3-oxopropyl)-6-(phenylmethoxymethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)CCN1CC(C(=O)OCC)CCC1COCc1ccccc1 |
| InChI | InChI=1S/C21H31NO5/c1-3-26-20(23)12-13-22-14-18(21(24)27-4-2)10-11-19(22)16-25-15-17-8-6-5-7-9-17/h5-9,18-19H,3-4,10-16H2,1-2H3 |
| InChIKey | ZAIDVBLEGBGWMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |