About 2,2-dichloroethanol
2,2-dichloroethanol (PubChem CID 11718) has the molecular formula C2H4Cl2O
and a molecular weight of 114.96 g/mol. Its IUPAC name is 2,2-dichloroethanol.
Molecular Properties
| Compound Name | 2,2-dichloroethanol |
| PubChem CID | 11718 |
| Molecular Formula | C2H4Cl2O |
| Molecular Weight | 114.96 g/mol |
| Exact Mass | 113.96 |
| IUPAC Name | 2,2-dichloroethanol |
| SMILES | OCC(Cl)Cl |
| InChI | InChI=1S/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2 |
| InChIKey | IDJOCJAIQSKSOP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.96 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroethanol?
The IUPAC name of 2,2-dichloroethanol (CID 11718) is 2,2-dichloroethanol.
What is the SMILES notation for 2,2-dichloroethanol?
The canonical SMILES for 2,2-dichloroethanol is OCC(Cl)Cl.
What is the InChIKey of 2,2-dichloroethanol?
The InChIKey is IDJOCJAIQSKSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2.
What are the key properties of 2,2-dichloroethanol?
2,2-dichloroethanol has a molecular weight of 114.96 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroethanol is sourced from PubChem (CID 11718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).