C17H16ClNO — CID 117184865
2-[(4-chlorophenoxy)methyl]-1,4-dimethylindole (PubChem CID 117184865) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]-1,4-dimethylindole.
| Compound Name | 2-[(4-chlorophenoxy)methyl]-1,4-dimethylindole |
|---|---|
| PubChem CID | 117184865 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]-1,4-dimethylindole |
| SMILES | Cc1cccc2c1cc(COc1ccc(Cl)cc1)n2C |
| InChI | InChI=1S/C17H16ClNO/c1-12-4-3-5-17-16(12)10-14(19(17)2)11-20-15-8-6-13(18)7-9-15/h3-10H,11H2,1-2H3 |
| InChIKey | AZJHSZCFFFOJJG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |