C11H13NO — CID 117120333
(1,4-dimethylindol-2-yl)methanol (PubChem CID 117120333) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (1,4-dimethylindol-2-yl)methanol.
| Compound Name | (1,4-dimethylindol-2-yl)methanol |
|---|---|
| PubChem CID | 117120333 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (1,4-dimethylindol-2-yl)methanol |
| SMILES | Cc1cccc2c1cc(CO)n2C |
| InChI | InChI=1S/C11H13NO/c1-8-4-3-5-11-10(8)6-9(7-13)12(11)2/h3-6,13H,7H2,1-2H3 |
| InChIKey | LBGZCUPSTSWXEG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |