C14H16N4 — CID 82387823
[3-(1,4-dimethylindol-2-yl)-1H-pyrazol-5-yl]methanamine (PubChem CID 82387823) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is [3-(1,4-dimethylindol-2-yl)-1H-pyrazol-5-yl]methanamine.
| Compound Name | [3-(1,4-dimethylindol-2-yl)-1H-pyrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82387823 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [3-(1,4-dimethylindol-2-yl)-1H-pyrazol-5-yl]methanamine |
| SMILES | Cc1cccc2c1cc(-c1cc(CN)[nH]n1)n2C |
| InChI | InChI=1S/C14H16N4/c1-9-4-3-5-13-11(9)7-14(18(13)2)12-6-10(8-15)16-17-12/h3-7H,8,15H2,1-2H3,(H,16,17) |
| InChIKey | LHRMXYSEFMYCRV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |