C14H19N — CID 121356408
2-tert-butyl-1,4-dimethylindole (PubChem CID 121356408) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-tert-butyl-1,4-dimethylindole.
| Compound Name | 2-tert-butyl-1,4-dimethylindole |
|---|---|
| PubChem CID | 121356408 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-tert-butyl-1,4-dimethylindole |
| SMILES | Cc1cccc2c1cc(C(C)(C)C)n2C |
| InChI | InChI=1S/C14H19N/c1-10-7-6-8-12-11(10)9-13(15(12)5)14(2,3)4/h6-9H,1-5H3 |
| InChIKey | VMULPPVPCOYYFN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |