C13H18N2 — CID 158530383
2-tert-butyl-1,4-dimethylpyrrolo[3,2-c]pyridine (PubChem CID 158530383) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-tert-butyl-1,4-dimethylpyrrolo[3,2-c]pyridine.
| Compound Name | 2-tert-butyl-1,4-dimethylpyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 158530383 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-tert-butyl-1,4-dimethylpyrrolo[3,2-c]pyridine |
| SMILES | Cc1nccc2c1cc(C(C)(C)C)n2C |
| InChI | InChI=1S/C13H18N2/c1-9-10-8-12(13(2,3)4)15(5)11(10)6-7-14-9/h6-8H,1-5H3 |
| InChIKey | IYIVSWHKCCYOOL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |