C15H17NS — CID 162696125
2-tert-butyl-3-methyl-[1]benzothiolo[2,3-b]pyrrole (PubChem CID 162696125) has the molecular formula C15H17NS and a molecular weight of 243.37 g/mol. Its IUPAC name is 2-tert-butyl-3-methyl-[1]benzothiolo[2,3-b]pyrrole.
| Compound Name | 2-tert-butyl-3-methyl-[1]benzothiolo[2,3-b]pyrrole |
|---|---|
| PubChem CID | 162696125 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-tert-butyl-3-methyl-[1]benzothiolo[2,3-b]pyrrole |
| SMILES | Cn1c(C(C)(C)C)cc2c3ccccc3sc21 |
| InChI | InChI=1S/C15H17NS/c1-15(2,3)13-9-11-10-7-5-6-8-12(10)17-14(11)16(13)4/h5-9H,1-4H3 |
| InChIKey | YLBZLHKMNWZPJP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |