C11H9NS — CID 13088474
3-methyl-[1]benzothiolo[2,3-b]pyrrole (PubChem CID 13088474) has the molecular formula C11H9NS and a molecular weight of 187.27 g/mol. Its IUPAC name is 3-methyl-[1]benzothiolo[2,3-b]pyrrole.
| Compound Name | 3-methyl-[1]benzothiolo[2,3-b]pyrrole |
|---|---|
| PubChem CID | 13088474 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 3-methyl-[1]benzothiolo[2,3-b]pyrrole |
| SMILES | Cn1ccc2c3ccccc3sc21 |
| InChI | InChI=1S/C11H9NS/c1-12-7-6-9-8-4-2-3-5-10(8)13-11(9)12/h2-7H,1H3 |
| InChIKey | YVOQUXPFJQCEOT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |