C13H13NS — CID 158099363
1,2,3-trimethyl-[1]benzothiolo[2,3-b]pyrrole (PubChem CID 158099363) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is 1,2,3-trimethyl-[1]benzothiolo[2,3-b]pyrrole.
| Compound Name | 1,2,3-trimethyl-[1]benzothiolo[2,3-b]pyrrole |
|---|---|
| PubChem CID | 158099363 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 1,2,3-trimethyl-[1]benzothiolo[2,3-b]pyrrole |
| SMILES | Cc1c(C)n(C)c2sc3ccccc3c12 |
| InChI | InChI=1S/C13H13NS/c1-8-9(2)14(3)13-12(8)10-6-4-5-7-11(10)15-13/h4-7H,1-3H3 |
| InChIKey | ZEHNERZXIOVFTL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |