C17H16FNO — CID 117186521
2-[(4-fluorophenoxy)methyl]-1,7-dimethylindole (PubChem CID 117186521) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-1,7-dimethylindole.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-1,7-dimethylindole |
|---|---|
| PubChem CID | 117186521 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-1,7-dimethylindole |
| SMILES | Cc1cccc2cc(COc3ccc(F)cc3)n(C)c12 |
| InChI | InChI=1S/C17H16FNO/c1-12-4-3-5-13-10-15(19(2)17(12)13)11-20-16-8-6-14(18)7-9-16/h3-10H,11H2,1-2H3 |
| InChIKey | LXAATMDNUOKYRE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |