C10H16N4O2 — CID 117187185
2-[(4-methylpiperazin-1-yl)methyl]-1H-imidazole-5-carboxylic acid (PubChem CID 117187185) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)methyl]-1H-imidazole-5-carboxylic acid.
| Compound Name | 2-[(4-methylpiperazin-1-yl)methyl]-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117187185 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)methyl]-1H-imidazole-5-carboxylic acid |
| SMILES | CN1CCN(Cc2ncc(C(=O)O)[nH]2)CC1 |
| InChI | InChI=1S/C10H16N4O2/c1-13-2-4-14(5-3-13)7-9-11-6-8(12-9)10(15)16/h6H,2-5,7H2,1H3,(H,11,12)(H,15,16) |
| InChIKey | AOZMPNVHTQDOBL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |