C9H15N3O2 — CID 117187507
2-[(dimethylamino)methyl]-1-ethylimidazole-4-carboxylic acid (PubChem CID 117187507) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1-ethylimidazole-4-carboxylic acid.
| Compound Name | 2-[(dimethylamino)methyl]-1-ethylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117187507 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1-ethylimidazole-4-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)nc1CN(C)C |
| InChI | InChI=1S/C9H15N3O2/c1-4-12-5-7(9(13)14)10-8(12)6-11(2)3/h5H,4,6H2,1-3H3,(H,13,14) |
| InChIKey | JCXDMNPZODQKGO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |