C8H12N2O4S — CID 117187211
2-(ethylsulfonylmethyl)-1-methylimidazole-4-carboxylic acid (PubChem CID 117187211) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-(ethylsulfonylmethyl)-1-methylimidazole-4-carboxylic acid.
| Compound Name | 2-(ethylsulfonylmethyl)-1-methylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117187211 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-(ethylsulfonylmethyl)-1-methylimidazole-4-carboxylic acid |
| SMILES | CCS(=O)(=O)Cc1nc(C(=O)O)cn1C |
| InChI | InChI=1S/C8H12N2O4S/c1-3-15(13,14)5-7-9-6(8(11)12)4-10(7)2/h4H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | FNUYEEPQOVOCQY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |