C8H13N3O2 — CID 117272800
ethyl 2-(aminomethyl)-1-methylimidazole-4-carboxylate (PubChem CID 117272800) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-1-methylimidazole-4-carboxylate.
| Compound Name | ethyl 2-(aminomethyl)-1-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 117272800 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | ethyl 2-(aminomethyl)-1-methylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(C)c(CN)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-3-13-8(12)6-5-11(2)7(4-9)10-6/h5H,3-4,9H2,1-2H3 |
| InChIKey | AKFKZEHDSOQFCR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |