C11H16N2O2SSi — CID 125474023
ethyl 2-trimethylsilylimidazo[2,1-b][1,3]thiazole-6-carboxylate (PubChem CID 125474023) has the molecular formula C11H16N2O2SSi and a molecular weight of 268.41 g/mol. Its IUPAC name is ethyl 2-trimethylsilylimidazo[2,1-b][1,3]thiazole-6-carboxylate.
| Compound Name | ethyl 2-trimethylsilylimidazo[2,1-b][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 125474023 |
| Molecular Formula | C11H16N2O2SSi |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | ethyl 2-trimethylsilylimidazo[2,1-b][1,3]thiazole-6-carboxylate |
| SMILES | CCOC(=O)c1cn2cc([Si](C)(C)C)sc2n1 |
| InChI | InChI=1S/C11H16N2O2SSi/c1-5-15-10(14)8-6-13-7-9(17(2,3)4)16-11(13)12-8/h6-7H,5H2,1-4H3 |
| InChIKey | NWSBUIPZIXPLEU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|