C28H24N6O6S2 — CID 158085251
ethyl 2-(2-aminophenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylate;ethyl 2-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylate (PubChem CID 158085251) has the molecular formula C28H24N6O6S2 and a molecular weight of 604.67 g/mol. Its IUPAC name is ethyl 2-(2-aminophenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylate;ethyl 2-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylate.
| Compound Name | ethyl 2-(2-aminophenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylate;ethyl 2-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 158085251 |
| Molecular Formula | C28H24N6O6S2 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | ethyl 2-(2-aminophenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylate;ethyl 2-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole-6-carboxylate |
| SMILES | CCOC(=O)c1cn2cc(-c3ccccc3N)sc2n1.CCOC(=O)c1cn2cc(-c3ccccc3[N+](=O)[O-])sc2n1 |
| InChI | InChI=1S/C14H11N3O4S.C14H13N3O2S/c1-2-21-13(18)10-7-16-8-12(22-14(16)15-10)9-5-3-4-6-11(9)17(19)20;1-2-19-13(18)11-7-17-8-12(20-14(17)16-11)9-5-3-4-6-10(9)15/h3-8H,2H2,1H3;3-8H,2,15H2,1H3 |
| InChIKey | FNKXZAQXSHNGEO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|