C11H7N3O2S — CID 150456791
2-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 150456791) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 2-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 150456791 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1cn2ccnc2s1 |
| InChI | InChI=1S/C11H7N3O2S/c15-14(16)9-4-2-1-3-8(9)10-7-13-6-5-12-11(13)17-10/h1-7H |
| InChIKey | HOYMWPMQFUWKLN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|