C11H6FN3O2S — CID 54770031
6-(2-fluoro-3-nitrophenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 54770031) has the molecular formula C11H6FN3O2S and a molecular weight of 263.25 g/mol. Its IUPAC name is 6-(2-fluoro-3-nitrophenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(2-fluoro-3-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 54770031 |
| Molecular Formula | C11H6FN3O2S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 6-(2-fluoro-3-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2cn3ccsc3n2)c1F |
| InChI | InChI=1S/C11H6FN3O2S/c12-10-7(2-1-3-9(10)15(16)17)8-6-14-4-5-18-11(14)13-8/h1-6H |
| InChIKey | BARJFXHDFXHHMY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|